CAS 918538-04-2 appears in our catalog under these names: Pyrrolo[2,1-f][1,2,4]triazine-2,4(1h,3h)-dione, 95%, Pyrrolo(2,1-f)(1,2,4)triazine-2,4(1H,3H)-dione, Pyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione, 97%, 97%, Pyrrolo[2,1-f][1,2,4]triazine-2,4-dione, 97%, Pyrrolo[2,1-f][1,2,4]triazine-2,4(1H,3H)-dione, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 100g, 1g, 25g, 250mg, 2,5g, 500mg, 10g.
1H-pyrrolo[2,1-f][1,2,4]triazine-2,4-dione (CAS 918538-04-2) is a chemical compound with the molecular formula C6H5N3O2 and a molecular weight of 151.12 g/mol. IUPAC name: 1H-pyrrolo[2,1-f][1,2,4]triazine-2,4-dione. InChIKey: AQTRWCPNROUMPO-UHFFFAOYSA-N.
| Molecular formula | C6H5N3O2 |
|---|---|
| Molecular weight | 151.12 g/mol |
| IUPAC name | 1H-pyrrolo[2,1-f][1,2,4]triazine-2,4-dione |
| InChIKey | AQTRWCPNROUMPO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=O)NC(=O)N2 |
Computed by PubChem (NCBI)