CAS 2055841-42-2 appears in our catalog under these names: 3-Bromo-2,4,5-trifluoroaniline 95%, 3-Bromo-2,4,5-trifluoroaniline, 97%, 97%, 3-Bromo-2,4,5-trifluoroaniline, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 1g, 5g, 25g, 100mg, 250mg, 10g.
3-bromo-2,4,5-trifluoroaniline (CAS 2055841-42-2) is a chemical compound with the molecular formula C6H3BrF3N and a molecular weight of 225.99 g/mol. IUPAC name: 3-bromo-2,4,5-trifluoroaniline. InChIKey: OYIVAXNGJISXFW-UHFFFAOYSA-N.
| Molecular formula | C6H3BrF3N |
|---|---|
| Molecular weight | 225.99 g/mol |
| IUPAC name | 3-bromo-2,4,5-trifluoroaniline |
| InChIKey | OYIVAXNGJISXFW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)F)N |
Computed by PubChem (NCBI)