CAS 2055848-71-8 is the registry number for (R)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate. Offered by: Biosynth. Available pack sizes: 0,1g.
Tert-butyl N-[(2R)-1,1-difluoro-3-hydroxypropan-2-yl]carbamate (CAS 2055848-71-8) is a chemical compound with the molecular formula C8H15F2NO3 and a molecular weight of 211.21 g/mol. IUPAC name: tert-butyl N-[(2R)-1,1-difluoro-3-hydroxypropan-2-yl]carbamate. InChIKey: NLSRUOLFFBDDOB-RXMQYKEDSA-N.
| Molecular formula | C8H15F2NO3 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1,1-difluoro-3-hydroxypropan-2-yl]carbamate |
| InChIKey | NLSRUOLFFBDDOB-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)C(F)F |
Computed by PubChem (NCBI)