CAS 2055849-11-9 is the registry number for (S)-tert-Butyl (1,1-difluoro-3-hydroxypropan-2-yl)carbamate, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.
Tert-butyl N-[(2S)-1,1-difluoro-3-hydroxypropan-2-yl]carbamate (CAS 2055849-11-9) is a chemical compound with the molecular formula C8H15F2NO3 and a molecular weight of 211.21 g/mol. IUPAC name: tert-butyl N-[(2S)-1,1-difluoro-3-hydroxypropan-2-yl]carbamate. InChIKey: NLSRUOLFFBDDOB-YFKPBYRVSA-N.
| Molecular formula | C8H15F2NO3 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | tert-butyl N-[(2S)-1,1-difluoro-3-hydroxypropan-2-yl]carbamate |
| InChIKey | NLSRUOLFFBDDOB-YFKPBYRVSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CO)C(F)F |
Computed by PubChem (NCBI)