Products 2055848-74-1
CAS 2055848-74-1 appears in our catalog under these names: 4,4-Dimethyl-1-[(1r)-1-phenylethyl]pyrrolidine-2,3,5-trione, 95%, 4,4-dimethyl-1-[(1R)-1-phenylethyl]pyrrolidine-2,3,5-trione, 97%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 500mg, 100mg.
4,4-dimethyl-1-[(1R)-1-phenylethyl]pyrrolidine-2,3,5-trione (CAS 2055848-74-1) is a chemical compound with the molecular formula C14H15NO3 and a molecular weight of 245.27 g/mol. IUPAC name: 4,4-dimethyl-1-[(1R)-1-phenylethyl]pyrrolidine-2,3,5-trione. InChIKey: UKNKEVVZJPNQQB-SECBINFHSA-N.
| Molecular formula | C14H15NO3 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 4,4-dimethyl-1-[(1R)-1-phenylethyl]pyrrolidine-2,3,5-trione |
| InChIKey | UKNKEVVZJPNQQB-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)N2C(=O)C(=O)C(C2=O)(C)C |
Computed by PubChem (NCBI)