CAS 2056261-41-5 appears in our catalog under these names: BRD0705, BRD0705, 98%, BRD0705/ 99.59% (existing batch purity), BRD0705, 99.86%. Offered by: GLPBio, AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 1mg, 2mg, 10mg, 25mg, 50mg, 100 mg.
(4S)-4-ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (CAS 2056261-41-5) is a chemical compound with the molecular formula C20H23N3O and a molecular weight of 321.4 g/mol. IUPAC name: (4S)-4-ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one. InChIKey: NCKLQXXBRWCYMA-FQEVSTJZSA-N.
| Molecular formula | C20H23N3O |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (4S)-4-ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| InChIKey | NCKLQXXBRWCYMA-FQEVSTJZSA-N |
| SMILES | CC[C@@]1(C2=C(NC3=C1C(=O)CC(C3)(C)C)NN=C2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)