CAS 2056261-42-6 appears in our catalog under these names: BRD5648, 99%, BRD5648, (4R)-4-Ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo(3,4-b)quinolin-5-one, BRD5648, 99.94%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 10mM/1mL.
(4R)-4-ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one (CAS 2056261-42-6) is a chemical compound with the molecular formula C20H23N3O and a molecular weight of 321.4 g/mol. IUPAC name: (4R)-4-ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one. InChIKey: NCKLQXXBRWCYMA-HXUWFJFHSA-N.
| Molecular formula | C20H23N3O |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | (4R)-4-ethyl-7,7-dimethyl-4-phenyl-1,6,8,9-tetrahydropyrazolo[5,4-b]quinolin-5-one |
| InChIKey | NCKLQXXBRWCYMA-HXUWFJFHSA-N |
| SMILES | CC[C@]1(C2=C(NC3=C1C(=O)CC(C3)(C)C)NN=C2)C4=CC=CC=C4 |
Computed by PubChem (NCBI)