CAS 205639-91-4 is the registry number for rac-((1R,2S,3R,4S)-3-Aminobicyclo(2.2.1)heptan-2-yl)methanol hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
[(1S,2R,3S,4R)-3-amino-2-bicyclo[2.2.1]heptanyl]methanol;hydrochloride (CAS 205639-91-4) is a chemical compound with the molecular formula C8H16ClNO and a molecular weight of 177.67 g/mol. IUPAC name: [(1S,2R,3S,4R)-3-amino-2-bicyclo[2.2.1]heptanyl]methanol;hydrochloride. InChIKey: JBSSFLCCAAVUFA-SZPCUAKFSA-N.
| Molecular formula | C8H16ClNO |
|---|---|
| Molecular weight | 177.67 g/mol |
| IUPAC name | [(1S,2R,3S,4R)-3-amino-2-bicyclo[2.2.1]heptanyl]methanol;hydrochloride |
| InChIKey | JBSSFLCCAAVUFA-SZPCUAKFSA-N |
| SMILES | C1C[C@@H]2C[C@H]1[C@H]([C@H]2N)CO.Cl |
Computed by PubChem (NCBI)