Products 90429-09-7

CAS 90429-09-7 is the registry number for 2-(4-Formyl-2-methoxy-5-nitrophenoxy)acetic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-formyl-2-methoxy-5-nitrophenoxy)acetic acid (CAS 90429-09-7) is a chemical compound with the molecular formula C10H9NO7 and a molecular weight of 255.18 g/mol. IUPAC name: 2-(4-formyl-2-methoxy-5-nitrophenoxy)acetic acid. InChIKey: OWVYIQJYENXHSX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO7
Molecular weight255.18 g/mol
IUPAC name2-(4-formyl-2-methoxy-5-nitrophenoxy)acetic acid
InChIKeyOWVYIQJYENXHSX-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C=O)[N+](=O)[O-])OCC(=O)O

Computed by PubChem (NCBI)