CAS 205748-06-7 appears in our catalog under these names: (2E)-3-(2,4,5-Trimethylphenyl)acrylic acid, 95%, 2,4,5-Trimethylcinnamic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
(E)-3-(2,4,5-trimethylphenyl)prop-2-enoic acid (CAS 205748-06-7) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: (E)-3-(2,4,5-trimethylphenyl)prop-2-enoic acid. InChIKey: OUSXTDXBZCOQIT-SNAWJCMRSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | (E)-3-(2,4,5-trimethylphenyl)prop-2-enoic acid |
| InChIKey | OUSXTDXBZCOQIT-SNAWJCMRSA-N |
| SMILES | CC1=CC(=C(C=C1C)/C=C/C(=O)O)C |
Computed by PubChem (NCBI)