CAS 205806-34-4 appears in our catalog under these names: 5-(4-Fluorophenyl)-4-phenyl-4H-1,2,4-triazole-3-thiol, 3-(4-fluorophenyl)-4-phenyl-4,5-dihydro-1H-1,2,4-triazole-5-thione, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 250mg, 2,5g, 1g.
3-(4-fluorophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 205806-34-4) is a chemical compound with the molecular formula C14H10FN3S and a molecular weight of 271.31 g/mol. IUPAC name: 3-(4-fluorophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: JBLDZFRIHNERAF-UHFFFAOYSA-N.
| Molecular formula | C14H10FN3S |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | JBLDZFRIHNERAF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NNC2=S)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)