CAS 497083-40-6 is the registry number for (4-(4-Fluorophenyl)(2,5-thiazolyl))-2-pyridylamine. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg, 5000mg.
4-(4-fluorophenyl)-N-pyridin-2-yl-1,3-thiazol-2-amine (CAS 497083-40-6) is a chemical compound with the molecular formula C14H10FN3S and a molecular weight of 271.31 g/mol. IUPAC name: 4-(4-fluorophenyl)-N-pyridin-2-yl-1,3-thiazol-2-amine. InChIKey: STXSPDSVGOEMPM-UHFFFAOYSA-N.
| Molecular formula | C14H10FN3S |
|---|---|
| Molecular weight | 271.31 g/mol |
| IUPAC name | 4-(4-fluorophenyl)-N-pyridin-2-yl-1,3-thiazol-2-amine |
| InChIKey | STXSPDSVGOEMPM-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)NC2=NC(=CS2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)