CAS 2758114-60-0 is the registry number for Tubulin polymerization-IN-61. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzotriazol-5-yl]phenol (CAS 2758114-60-0) is a chemical compound with the molecular formula C22H21N3O5 and a molecular weight of 407.4 g/mol. IUPAC name: 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzotriazol-5-yl]phenol. InChIKey: IWDPVPZMBTZRQM-UHFFFAOYSA-N.
| Molecular formula | C22H21N3O5 |
|---|---|
| Molecular weight | 407.4 g/mol |
| IUPAC name | 2-methoxy-5-[3-(3,4,5-trimethoxyphenyl)benzotriazol-5-yl]phenol |
| InChIKey | IWDPVPZMBTZRQM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC3=C(C=C2)N=NN3C4=CC(=C(C(=C4)OC)OC)OC)O |
Computed by PubChem (NCBI)