CAS 20592-42-1 is the registry number for Estrone Enol Diacetate, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5g, 250mg.
[(8R,9S,13S,14S)-3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] acetate (CAS 20592-42-1) is a chemical compound with the molecular formula C22H26O4 and a molecular weight of 354.4 g/mol. IUPAC name: [(8R,9S,13S,14S)-3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] acetate. InChIKey: KPJNGUPMJAHAND-JBPLPALLSA-N.
| Molecular formula | C22H26O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | [(8R,9S,13S,14S)-3-acetyloxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-17-yl] acetate |
| InChIKey | KPJNGUPMJAHAND-JBPLPALLSA-N |
| SMILES | CC(=O)OC1=CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CCC4=C3C=CC(=C4)OC(=O)C)C |
Computed by PubChem (NCBI)