CAS 565171-31-5 appears in our catalog under these names: 3-[4-(4-tert-Butyl-benzyloxy)-3-ethoxy-phenyl]-acrylic acid, 95%, 3-{4-((4-tert-butylphenyl)methoxy)-3-ethoxyphenyl}prop-2-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(E)-3-[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]prop-2-enoic acid (CAS 565171-31-5) is a chemical compound with the molecular formula C22H26O4 and a molecular weight of 354.4 g/mol. IUPAC name: (E)-3-[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]prop-2-enoic acid. InChIKey: KCIZJZMPDKEYJR-UKTHLTGXSA-N.
| Molecular formula | C22H26O4 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (E)-3-[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]prop-2-enoic acid |
| InChIKey | KCIZJZMPDKEYJR-UKTHLTGXSA-N |
| SMILES | CCOC1=C(C=CC(=C1)/C=C/C(=O)O)OCC2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)