Products 2059910-82-4
CAS 2059910-82-4 is the registry number for rac-3-((2R,3S)-3-Methyloxolan-2-yl)-4-(propan-2-yl)-4,5-dihydro-1H-1,2,4-triazol-5-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-[(2R,3S)-3-methyloxolan-2-yl]-4-propan-2-yl-1H-1,2,4-triazol-5-one (CAS 2059910-82-4) is a chemical compound with the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. IUPAC name: 3-[(2R,3S)-3-methyloxolan-2-yl]-4-propan-2-yl-1H-1,2,4-triazol-5-one. InChIKey: IEZDNLQRENWHCC-JGVFFNPUSA-N.
| Molecular formula | C10H17N3O2 |
|---|---|
| Molecular weight | 211.26 g/mol |
| IUPAC name | 3-[(2R,3S)-3-methyloxolan-2-yl]-4-propan-2-yl-1H-1,2,4-triazol-5-one |
| InChIKey | IEZDNLQRENWHCC-JGVFFNPUSA-N |
| SMILES | C[C@H]1CCO[C@H]1C2=NNC(=O)N2C(C)C |
Computed by PubChem (NCBI)