CAS 2059910-88-0 is the registry number for (3S)-3-Amino-3-(3-iodophenyl)propanoic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(3S)-3-amino-3-(3-iodophenyl)propanoic acid;hydrochloride (CAS 2059910-88-0) is a chemical compound with the molecular formula C9H11ClINO2 and a molecular weight of 327.54 g/mol. IUPAC name: (3S)-3-amino-3-(3-iodophenyl)propanoic acid;hydrochloride. InChIKey: NPODVCXCPWIDEX-QRPNPIFTSA-N.
| Molecular formula | C9H11ClINO2 |
|---|---|
| Molecular weight | 327.54 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-iodophenyl)propanoic acid;hydrochloride |
| InChIKey | NPODVCXCPWIDEX-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC(=C1)I)[C@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)