Products 910304-89-1
CAS 910304-89-1 is the registry number for Methyl 5-(aminomethyl)-2-iodobenzoate hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-(aminomethyl)-2-iodobenzoate;hydrochloride (CAS 910304-89-1) is a chemical compound with the molecular formula C9H11ClINO2 and a molecular weight of 327.54 g/mol. IUPAC name: methyl 5-(aminomethyl)-2-iodobenzoate;hydrochloride. InChIKey: ZNSJSVSSMOUOKD-UHFFFAOYSA-N.
| Molecular formula | C9H11ClINO2 |
|---|---|
| Molecular weight | 327.54 g/mol |
| IUPAC name | methyl 5-(aminomethyl)-2-iodobenzoate;hydrochloride |
| InChIKey | ZNSJSVSSMOUOKD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)CN)I.Cl |
Computed by PubChem (NCBI)