CAS 2059914-63-3 is the registry number for (1S,3S)-3-(Phenylsulfanyl)cyclobutyl methanesulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3-phenylsulfanylcyclobutyl) methanesulfonate (CAS 2059914-63-3) is a chemical compound with the molecular formula C11H14O3S2 and a molecular weight of 258.4 g/mol. IUPAC name: (3-phenylsulfanylcyclobutyl) methanesulfonate. InChIKey: JMSGLCMLAGAKJL-UHFFFAOYSA-N.
| Molecular formula | C11H14O3S2 |
|---|---|
| Molecular weight | 258.4 g/mol |
| IUPAC name | (3-phenylsulfanylcyclobutyl) methanesulfonate |
| InChIKey | JMSGLCMLAGAKJL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OC1CC(C1)SC2=CC=CC=C2 |
Computed by PubChem (NCBI)