Products 2222151-21-3

CAS 2222151-21-3 is the registry number for 2-((2-Hydroxyethyl)disulfanyl)ethyl benzoate, 98%. Offered by: AmBeed, Fluorochem. Available pack sizes: 5g, 100mg, 250mg.

2-(2-hydroxyethyldisulfanyl)ethyl benzoate (CAS 2222151-21-3) is a chemical compound with the molecular formula C11H14O3S2 and a molecular weight of 258.4 g/mol. IUPAC name: 2-(2-hydroxyethyldisulfanyl)ethyl benzoate. InChIKey: ZVSUDWLDDIIAET-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O3S2
Molecular weight258.4 g/mol
IUPAC name2-(2-hydroxyethyldisulfanyl)ethyl benzoate
InChIKeyZVSUDWLDDIIAET-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)OCCSSCCO

Computed by PubChem (NCBI)