Products 2059914-94-0
CAS 2059914-94-0 is the registry number for rac-Methyl (3R,4R)-3,4-dimethylpyrrolidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl (3R,4R)-3,4-dimethylpyrrolidine-3-carboxylate (CAS 2059914-94-0) is a chemical compound with the molecular formula C8H15NO2 and a molecular weight of 157.21 g/mol. IUPAC name: methyl (3R,4R)-3,4-dimethylpyrrolidine-3-carboxylate. InChIKey: VXQVHJJNBMOBOI-XPUUQOCRSA-N.
| Molecular formula | C8H15NO2 |
|---|---|
| Molecular weight | 157.21 g/mol |
| IUPAC name | methyl (3R,4R)-3,4-dimethylpyrrolidine-3-carboxylate |
| InChIKey | VXQVHJJNBMOBOI-XPUUQOCRSA-N |
| SMILES | C[C@H]1CNC[C@]1(C)C(=O)OC |
Computed by PubChem (NCBI)