CAS 2059934-12-0 appears in our catalog under these names: 1,4-Difluoro-2-(S-methylsulfonimidoyl)benzene, 95%, 1,4-Difluoro-2-(S-methylsulfonimidoyl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
(2,5-difluorophenyl)-imino-methyl-oxo-lambda6-sulfane (CAS 2059934-12-0) is a chemical compound with the molecular formula C7H7F2NOS and a molecular weight of 191.20 g/mol. IUPAC name: (2,5-difluorophenyl)-imino-methyl-oxo-lambda6-sulfane. InChIKey: NCVMYQKRTYFNSP-UHFFFAOYSA-N.
| Molecular formula | C7H7F2NOS |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | (2,5-difluorophenyl)-imino-methyl-oxo-lambda6-sulfane |
| InChIKey | NCVMYQKRTYFNSP-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)