CAS 2060057-27-2 appears in our catalog under these names: (2,4-Difluorophenyl)(imino)methyl-lambda6-sulfanone, 95%, (2,4-Difluorophenyl)(imino)methyl-λ6-sulfanone. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
(2,4-difluorophenyl)-imino-methyl-oxo-lambda6-sulfane (CAS 2060057-27-2) is a chemical compound with the molecular formula C7H7F2NOS and a molecular weight of 191.20 g/mol. IUPAC name: (2,4-difluorophenyl)-imino-methyl-oxo-lambda6-sulfane. InChIKey: BZVOUVJPLQUCPY-UHFFFAOYSA-N.
| Molecular formula | C7H7F2NOS |
|---|---|
| Molecular weight | 191.20 g/mol |
| IUPAC name | (2,4-difluorophenyl)-imino-methyl-oxo-lambda6-sulfane |
| InChIKey | BZVOUVJPLQUCPY-UHFFFAOYSA-N |
| SMILES | CS(=N)(=O)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)