CAS 2059941-95-4 appears in our catalog under these names: Potassium 2-(5-methyl-1,3-oxazol-2-yl)acetate, 95%, Potassium 2-(5-methyl-1,3-oxazol-2-yl)acetate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
Potassium 2-(5-methyl-1,3-oxazol-2-yl)acetate (CAS 2059941-95-4) is a chemical compound with the molecular formula C6H6KNO3 and a molecular weight of 179.21 g/mol. IUPAC name: potassium 2-(5-methyl-1,3-oxazol-2-yl)acetate. InChIKey: AQGMGOMYTAMCIM-UHFFFAOYSA-M.
| Molecular formula | C6H6KNO3 |
|---|---|
| Molecular weight | 179.21 g/mol |
| IUPAC name | potassium 2-(5-methyl-1,3-oxazol-2-yl)acetate |
| InChIKey | AQGMGOMYTAMCIM-UHFFFAOYSA-M |
| SMILES | CC1=CN=C(O1)CC(=O)[O-].[K+] |
Computed by PubChem (NCBI)