CAS 92664-05-6 appears in our catalog under these names: Propanoic acid, 3-cyano-2-oxo-, ethyl ester, ion(1-), potassium, 95%, 95%, Potassium 1-cyano-3-ethoxy-2,3-dioxopropan-1-ide, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg.
Potassium ethyl 3-cyano-2-oxopropanoate (CAS 92664-05-6) is a chemical compound with the molecular formula C6H6KNO3 and a molecular weight of 179.21 g/mol. IUPAC name: potassium ethyl 3-cyano-2-oxopropanoate. InChIKey: PIMPOWCURRWILD-UHFFFAOYSA-N.
| Molecular formula | C6H6KNO3 |
|---|---|
| Molecular weight | 179.21 g/mol |
| IUPAC name | potassium ethyl 3-cyano-2-oxopropanoate |
| InChIKey | PIMPOWCURRWILD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=O)[CH-]C#N.[K+] |
Computed by PubChem (NCBI)