CAS 2059948-72-8 is the registry number for 2-Methanesulfonylcyclopropane-1,1-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-methylsulfonylcyclopropane-1,1-dicarboxylic acid (CAS 2059948-72-8) is a chemical compound with the molecular formula C6H8O6S and a molecular weight of 208.19 g/mol. IUPAC name: 2-methylsulfonylcyclopropane-1,1-dicarboxylic acid. InChIKey: PGBGBZSNXSBKQU-UHFFFAOYSA-N.
| Molecular formula | C6H8O6S |
|---|---|
| Molecular weight | 208.19 g/mol |
| IUPAC name | 2-methylsulfonylcyclopropane-1,1-dicarboxylic acid |
| InChIKey | PGBGBZSNXSBKQU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1CC1(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)