CAS 99-68-3 appears in our catalog under these names: 2-((Carboxymethyl)thio)succinic acid 97%, 2-[(Carboxymethyl)thio]butanedioic acid, 98%, 98%, 2-((Carboxymethyl)thio)succinic acid, 98%, N-Boc-4-chloro-3-fluoroaniline, ≥97-<99%. Offered by: Ambeed, Chemat, Fluorochem, Hoffman Fine Chemicals. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg, 10g, 50g.
2-(carboxymethylsulfanyl)butanedioic acid (CAS 99-68-3) is a chemical compound with the molecular formula C6H8O6S and a molecular weight of 208.19 g/mol. IUPAC name: 2-(carboxymethylsulfanyl)butanedioic acid. InChIKey: JPHVSDWIWBDHOC-UHFFFAOYSA-N.
| Molecular formula | C6H8O6S |
|---|---|
| Molecular weight | 208.19 g/mol |
| IUPAC name | 2-(carboxymethylsulfanyl)butanedioic acid |
| InChIKey | JPHVSDWIWBDHOC-UHFFFAOYSA-N |
| SMILES | C(C(C(=O)O)SCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)