CAS 2059950-54-6 is the registry number for 3-{5,7-Dimethyl-4H,5H,6H,7H-pyrazolo(1,5-a)pyrimidin-6-yl}propanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(5,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid (CAS 2059950-54-6) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: 3-(5,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid. InChIKey: CBMOPDGKSHYFHW-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 3-(5,7-dimethyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-6-yl)propanoic acid |
| InChIKey | CBMOPDGKSHYFHW-UHFFFAOYSA-N |
| SMILES | CC1C(C(N2C(=CC=N2)N1)C)CCC(=O)O |
Computed by PubChem (NCBI)