CAS 2059963-66-3 appears in our catalog under these names: Rel-(3S,5R)-4,4-difluoro-3,5-dimethylpiperidine, 98%, cis-3,5-Dimethyl-4,4-difluoropiperidine, 95%, 95%, cis-3,5-Dimethyl-4,4-difluoropiperidine, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
(3S,5R)-4,4-difluoro-3,5-dimethylpiperidine (CAS 2059963-66-3) is a chemical compound with the molecular formula C7H13F2N and a molecular weight of 149.18 g/mol. IUPAC name: (3S,5R)-4,4-difluoro-3,5-dimethylpiperidine. InChIKey: ZYRQFDWQZXHTCE-OLQVQODUSA-N.
| Molecular formula | C7H13F2N |
|---|---|
| Molecular weight | 149.18 g/mol |
| IUPAC name | (3S,5R)-4,4-difluoro-3,5-dimethylpiperidine |
| InChIKey | ZYRQFDWQZXHTCE-OLQVQODUSA-N |
| SMILES | C[C@@H]1CNC[C@@H](C1(F)F)C |
Computed by PubChem (NCBI)