Products 2059975-65-2

CAS 2059975-65-2 is the registry number for Tricyclo(3.2.1.0,2,4)octane-6-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Tricyclo[3.2.1.02,4]octane-6-carboxylic acid (CAS 2059975-65-2) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. IUPAC name: tricyclo[3.2.1.02,4]octane-6-carboxylic acid. InChIKey: VHPSMBLOFPORJW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O2
Molecular weight152.19 g/mol
IUPAC nametricyclo[3.2.1.02,4]octane-6-carboxylic acid
InChIKeyVHPSMBLOFPORJW-UHFFFAOYSA-N
SMILESC1C2CC(C1C3C2C3)C(=O)O

Computed by PubChem (NCBI)