Products 2059988-37-1

CAS 2059988-37-1 is the registry number for 3-(Aminomethyl)oxane-3-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

3-(aminomethyl)oxane-3-carboxylic acid;hydrochloride (CAS 2059988-37-1) is a chemical compound with the molecular formula C7H14ClNO3 and a molecular weight of 195.64 g/mol. IUPAC name: 3-(aminomethyl)oxane-3-carboxylic acid;hydrochloride. InChIKey: GICNVKPFRVCGJV-UHFFFAOYSA-N.

Identity
Molecular formulaC7H14ClNO3
Molecular weight195.64 g/mol
IUPAC name3-(aminomethyl)oxane-3-carboxylic acid;hydrochloride
InChIKeyGICNVKPFRVCGJV-UHFFFAOYSA-N
SMILESC1CC(COC1)(CN)C(=O)O.Cl

Computed by PubChem (NCBI)