CAS 2059988-39-3 is the registry number for Mexiletine EP Impurity C DiHCl. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-[4-(2-aminopropoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]propan-2-amine;dihydrochloride (CAS 2059988-39-3) is a chemical compound with the molecular formula C22H34Cl2N2O2 and a molecular weight of 429.4 g/mol. IUPAC name: 1-[4-[4-(2-aminopropoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]propan-2-amine;dihydrochloride. InChIKey: PGPQLOIWQPXSEW-UHFFFAOYSA-N.
| Molecular formula | C22H34Cl2N2O2 |
|---|---|
| Molecular weight | 429.4 g/mol |
| IUPAC name | 1-[4-[4-(2-aminopropoxy)-3,5-dimethylphenyl]-2,6-dimethylphenoxy]propan-2-amine;dihydrochloride |
| InChIKey | PGPQLOIWQPXSEW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OCC(C)N)C)C2=CC(=C(C(=C2)C)OCC(C)N)C.Cl.Cl |
Computed by PubChem (NCBI)