CAS 86484-91-5 appears in our catalog under these names: Dopexamine hydrochloride (FPL60278AR), Dopexamine Dihydrochloride, Dopexamine Hydrochloride, >95% (HPLC), Dopexamine hydrochloride/ 99.77% (existing batch purity), Dopexamine hydrochloride. Offered by: GLPBio, Chemat Brand, Hubei YoungXin, TRC, TargetMol. Available pack sizes: 5mg, on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol;dihydrochloride (CAS 86484-91-5) is a chemical compound with the molecular formula C22H34Cl2N2O2 and a molecular weight of 429.4 g/mol. IUPAC name: 4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol;dihydrochloride. InChIKey: VPDULUNRSQWWJB-UHFFFAOYSA-N.
| Molecular formula | C22H34Cl2N2O2 |
|---|---|
| Molecular weight | 429.4 g/mol |
| IUPAC name | 4-[2-[6-(2-phenylethylamino)hexylamino]ethyl]benzene-1,2-diol;dihydrochloride |
| InChIKey | VPDULUNRSQWWJB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNCCCCCCNCCC2=CC(=C(C=C2)O)O.Cl.Cl |
Computed by PubChem (NCBI)