CAS 2060000-63-5 is the registry number for {4-((6-amino-1H-indol-1-yl)methyl)phenyl}methanol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
[4-[(6-aminoindol-1-yl)methyl]phenyl]methanol;hydrochloride (CAS 2060000-63-5) is a chemical compound with the molecular formula C16H17ClN2O and a molecular weight of 288.77 g/mol. IUPAC name: [4-[(6-aminoindol-1-yl)methyl]phenyl]methanol;hydrochloride. InChIKey: GSBVRAFQPAKURN-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | [4-[(6-aminoindol-1-yl)methyl]phenyl]methanol;hydrochloride |
| InChIKey | GSBVRAFQPAKURN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CN2CC3=CC=C(C=C3)CO)N.Cl |
Computed by PubChem (NCBI)