CAS 2279122-54-0 is the registry number for 5-Amino-4'-chloro-biphenyl-3-carboxylic acid isopropylamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-amino-5-(4-chlorophenyl)-N-propan-2-ylbenzamide (CAS 2279122-54-0) is a chemical compound with the molecular formula C16H17ClN2O and a molecular weight of 288.77 g/mol. IUPAC name: 3-amino-5-(4-chlorophenyl)-N-propan-2-ylbenzamide. InChIKey: YSWDVLGJHDKDEO-UHFFFAOYSA-N.
| Molecular formula | C16H17ClN2O |
|---|---|
| Molecular weight | 288.77 g/mol |
| IUPAC name | 3-amino-5-(4-chlorophenyl)-N-propan-2-ylbenzamide |
| InChIKey | YSWDVLGJHDKDEO-UHFFFAOYSA-N |
| SMILES | CC(C)NC(=O)C1=CC(=CC(=C1)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)