CAS 2060006-38-2 is the registry number for 2-(5-Methyl-2-oxo-2,3-dihydro-1,3,4-oxadiazol-3-yl)ethane-1-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(5-methyl-2-oxo-1,3,4-oxadiazol-3-yl)ethanesulfonyl chloride (CAS 2060006-38-2) is a chemical compound with the molecular formula C5H7ClN2O4S and a molecular weight of 226.64 g/mol. IUPAC name: 2-(5-methyl-2-oxo-1,3,4-oxadiazol-3-yl)ethanesulfonyl chloride. InChIKey: AWAIPQIRWKLEBI-UHFFFAOYSA-N.
| Molecular formula | C5H7ClN2O4S |
|---|---|
| Molecular weight | 226.64 g/mol |
| IUPAC name | 2-(5-methyl-2-oxo-1,3,4-oxadiazol-3-yl)ethanesulfonyl chloride |
| InChIKey | AWAIPQIRWKLEBI-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=O)O1)CCS(=O)(=O)Cl |
Computed by PubChem (NCBI)