CAS 674348-00-6 appears in our catalog under these names: (4-Methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl chloride, 95%, (4-Methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,05g, 0,1g, 0,25g, 0,5g.
(4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl chloride (CAS 674348-00-6) is a chemical compound with the molecular formula C5H7ClN2O4S and a molecular weight of 226.64 g/mol. IUPAC name: (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl chloride. InChIKey: GXBXYLVXNQXXNV-UHFFFAOYSA-N.
| Molecular formula | C5H7ClN2O4S |
|---|---|
| Molecular weight | 226.64 g/mol |
| IUPAC name | (4-methyl-2,5-dioxoimidazolidin-4-yl)methanesulfonyl chloride |
| InChIKey | GXBXYLVXNQXXNV-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC(=O)N1)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)