CAS 2060020-52-0 is the registry number for 2,3-Diamino-1-phenylbutan-1-ol dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,3-diamino-1-phenylbutan-1-ol;dihydrochloride (CAS 2060020-52-0) is a chemical compound with the molecular formula C10H18Cl2N2O and a molecular weight of 253.17 g/mol. IUPAC name: 2,3-diamino-1-phenylbutan-1-ol;dihydrochloride. InChIKey: FKKKOVCRKYEAAU-UHFFFAOYSA-N.
| Molecular formula | C10H18Cl2N2O |
|---|---|
| Molecular weight | 253.17 g/mol |
| IUPAC name | 2,3-diamino-1-phenylbutan-1-ol;dihydrochloride |
| InChIKey | FKKKOVCRKYEAAU-UHFFFAOYSA-N |
| SMILES | CC(C(C(C1=CC=CC=C1)O)N)N.Cl.Cl |
Computed by PubChem (NCBI)