CAS 2227829-30-1 is the registry number for 4-(Propan-2-yl)-2-((2S)-pyrrolidin-2-yl)-1,3-oxazole dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-propan-2-yl-2-[(2S)-pyrrolidin-2-yl]-1,3-oxazole;dihydrochloride (CAS 2227829-30-1) is a chemical compound with the molecular formula C10H18Cl2N2O and a molecular weight of 253.17 g/mol. IUPAC name: 4-propan-2-yl-2-[(2S)-pyrrolidin-2-yl]-1,3-oxazole;dihydrochloride. InChIKey: NRRZWVWAIIKFGQ-JZGIKJSDSA-N.
| Molecular formula | C10H18Cl2N2O |
|---|---|
| Molecular weight | 253.17 g/mol |
| IUPAC name | 4-propan-2-yl-2-[(2S)-pyrrolidin-2-yl]-1,3-oxazole;dihydrochloride |
| InChIKey | NRRZWVWAIIKFGQ-JZGIKJSDSA-N |
| SMILES | CC(C)C1=COC(=N1)[C@@H]2CCCN2.Cl.Cl |
Computed by PubChem (NCBI)