Products 2060020-57-5
CAS 2060020-57-5 is the registry number for 1-(4-bromo-3-methylphenyl)cyclopentanol, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
1-(4-bromo-3-methylphenyl)cyclopentan-1-ol (CAS 2060020-57-5) is a chemical compound with the molecular formula C12H15BrO and a molecular weight of 255.15 g/mol. IUPAC name: 1-(4-bromo-3-methylphenyl)cyclopentan-1-ol. InChIKey: RQJTWIPRZPCRHW-UHFFFAOYSA-N.
| Molecular formula | C12H15BrO |
|---|---|
| Molecular weight | 255.15 g/mol |
| IUPAC name | 1-(4-bromo-3-methylphenyl)cyclopentan-1-ol |
| InChIKey | RQJTWIPRZPCRHW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2(CCCC2)O)Br |
Computed by PubChem (NCBI)