CAS 2060040-09-5 is the registry number for Sodium 4-cyclopropyl-1,3-thiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Sodium 4-cyclopropyl-1,3-thiazole-2-carboxylate (CAS 2060040-09-5) is a chemical compound with the molecular formula C7H6NNaO2S and a molecular weight of 191.18 g/mol. IUPAC name: sodium 4-cyclopropyl-1,3-thiazole-2-carboxylate. InChIKey: YPXNCASSNJLXSQ-UHFFFAOYSA-M.
| Molecular formula | C7H6NNaO2S |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | sodium 4-cyclopropyl-1,3-thiazole-2-carboxylate |
| InChIKey | YPXNCASSNJLXSQ-UHFFFAOYSA-M |
| SMILES | C1CC1C2=CSC(=N2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)