CAS 2361732-44-5 is the registry number for Sodium 4H,5H,6H-cyclopenta(D)(1,3)thiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylate (CAS 2361732-44-5) is a chemical compound with the molecular formula C7H6NNaO2S and a molecular weight of 191.18 g/mol. IUPAC name: sodium 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylate. InChIKey: CFQLJBXUKSEWHH-UHFFFAOYSA-M.
| Molecular formula | C7H6NNaO2S |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | sodium 5,6-dihydro-4H-cyclopenta[d][1,3]thiazole-2-carboxylate |
| InChIKey | CFQLJBXUKSEWHH-UHFFFAOYSA-M |
| SMILES | C1CC2=C(C1)SC(=N2)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)