CAS 2060051-12-7 is the registry number for 2-Ethyl-5-formyl-N,N-dimethyl-1H-imidazole-1-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-ethyl-5-formyl-N,N-dimethylimidazole-1-sulfonamide (CAS 2060051-12-7) is a chemical compound with the molecular formula C8H13N3O3S and a molecular weight of 231.27 g/mol. IUPAC name: 2-ethyl-5-formyl-N,N-dimethylimidazole-1-sulfonamide. InChIKey: HKSCPYHWJZLHGC-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O3S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | 2-ethyl-5-formyl-N,N-dimethylimidazole-1-sulfonamide |
| InChIKey | HKSCPYHWJZLHGC-UHFFFAOYSA-N |
| SMILES | CCC1=NC=C(N1S(=O)(=O)N(C)C)C=O |
Computed by PubChem (NCBI)