CAS 2866333-37-9 is the registry number for 6-Amino-5-methoxy-N,N-dimethylpyridine-3-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-5-methoxy-N,N-dimethylpyridine-3-sulfonamide (CAS 2866333-37-9) is a chemical compound with the molecular formula C8H13N3O3S and a molecular weight of 231.27 g/mol. IUPAC name: 6-amino-5-methoxy-N,N-dimethylpyridine-3-sulfonamide. InChIKey: GJHLWZJIRAMRIL-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O3S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | 6-amino-5-methoxy-N,N-dimethylpyridine-3-sulfonamide |
| InChIKey | GJHLWZJIRAMRIL-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(N=C1)N)OC |
Computed by PubChem (NCBI)