CAS 2060063-94-5 appears in our catalog under these names: 2-Chloro-N-{((3-chlorophenyl)carbamoyl)methyl}-N-methylacetamide, 95%, 2-Chloro-N-{((3-chlorophenyl)carbamoyl)methyl}-N-methylacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
2-[(2-chloroacetyl)-methylamino]-N-(3-chlorophenyl)acetamide (CAS 2060063-94-5) is a chemical compound with the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. IUPAC name: 2-[(2-chloroacetyl)-methylamino]-N-(3-chlorophenyl)acetamide. InChIKey: SGTINGVBUMRFHY-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O2 |
|---|---|
| Molecular weight | 275.13 g/mol |
| IUPAC name | 2-[(2-chloroacetyl)-methylamino]-N-(3-chlorophenyl)acetamide |
| InChIKey | SGTINGVBUMRFHY-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)NC1=CC(=CC=C1)Cl)C(=O)CCl |
Computed by PubChem (NCBI)