CAS 2070014-72-9 appears in our catalog under these names: 2–Amino–3–(7–chloro–1H–indol–3–yl)propanoic acid (hydrochloride), 2-Amino-3-(7-chloro-1H-indol-3-yl)propanoic acid (hydrochloride), 97%, 97%, 2-AMINO-3-(7-CHLORO-1H-INDOL-3-YL)PROPANOIC ACID (HCL), 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
2-amino-3-(7-chloro-1H-indol-3-yl)propanoic acid;hydrochloride (CAS 2070014-72-9) is a chemical compound with the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. IUPAC name: 2-amino-3-(7-chloro-1H-indol-3-yl)propanoic acid;hydrochloride. InChIKey: NSRKGSISAZLLDC-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2O2 |
|---|---|
| Molecular weight | 275.13 g/mol |
| IUPAC name | 2-amino-3-(7-chloro-1H-indol-3-yl)propanoic acid;hydrochloride |
| InChIKey | NSRKGSISAZLLDC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC=C2CC(C(=O)O)N.Cl |
Computed by PubChem (NCBI)