CAS 206008-37-9 appears in our catalog under these names: Diethyl ((2,5-dichlorophenyl)methyl)phosphonate, 95%, Diethyl ((2,5-dichlorophenyl)methyl)phosphonate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1,4-dichloro-2-(diethoxyphosphorylmethyl)benzene (CAS 206008-37-9) is a chemical compound with the molecular formula C11H15Cl2O3P and a molecular weight of 297.11 g/mol. IUPAC name: 1,4-dichloro-2-(diethoxyphosphorylmethyl)benzene. InChIKey: RCXBPHNDURWDBU-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2O3P |
|---|---|
| Molecular weight | 297.11 g/mol |
| IUPAC name | 1,4-dichloro-2-(diethoxyphosphorylmethyl)benzene |
| InChIKey | RCXBPHNDURWDBU-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=C(C=CC(=C1)Cl)Cl)OCC |
Computed by PubChem (NCBI)