CAS 57277-24-4 is the registry number for Diethyl (2,4-dichlorobenzyl)phosphonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-1-(diethoxyphosphorylmethyl)benzene (CAS 57277-24-4) is a chemical compound with the molecular formula C11H15Cl2O3P and a molecular weight of 297.11 g/mol. IUPAC name: 2,4-dichloro-1-(diethoxyphosphorylmethyl)benzene. InChIKey: LHPCNVJHBAMUPX-UHFFFAOYSA-N.
| Molecular formula | C11H15Cl2O3P |
|---|---|
| Molecular weight | 297.11 g/mol |
| IUPAC name | 2,4-dichloro-1-(diethoxyphosphorylmethyl)benzene |
| InChIKey | LHPCNVJHBAMUPX-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=C(C=C(C=C1)Cl)Cl)OCC |
Computed by PubChem (NCBI)