CAS 2062661-39-4 is the registry number for Ethyl (3S,4S)-1-benzyl-4-methylpyrrolidine-3-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl (3S,4S)-1-benzyl-4-methylpyrrolidine-3-carboxylate (CAS 2062661-39-4) is a chemical compound with the molecular formula C15H21NO2 and a molecular weight of 247.33 g/mol. IUPAC name: ethyl (3S,4S)-1-benzyl-4-methylpyrrolidine-3-carboxylate. InChIKey: GDZPWQCQDBQIJJ-TZMCWYRMSA-N.
| Molecular formula | C15H21NO2 |
|---|---|
| Molecular weight | 247.33 g/mol |
| IUPAC name | ethyl (3S,4S)-1-benzyl-4-methylpyrrolidine-3-carboxylate |
| InChIKey | GDZPWQCQDBQIJJ-TZMCWYRMSA-N |
| SMILES | CCOC(=O)[C@@H]1CN(C[C@H]1C)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)