CAS 20628-33-5 is the registry number for 2-Amino-5-nitrobenzenesulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-amino-5-nitrobenzenesulfonyl chloride (CAS 20628-33-5) is a chemical compound with the molecular formula C6H5ClN2O4S and a molecular weight of 236.63 g/mol. IUPAC name: 2-amino-5-nitrobenzenesulfonyl chloride. InChIKey: GIYARLIXINTLTK-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN2O4S |
|---|---|
| Molecular weight | 236.63 g/mol |
| IUPAC name | 2-amino-5-nitrobenzenesulfonyl chloride |
| InChIKey | GIYARLIXINTLTK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])S(=O)(=O)Cl)N |
Computed by PubChem (NCBI)